C22H34O4 — CID 144557341
butanoic acid;6-[2-(2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl)ethyl]oxan-2-one (PubChem CID 144557341) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is butanoic acid;6-[2-(2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl)ethyl]oxan-2-one.
| Compound Name | butanoic acid;6-[2-(2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl)ethyl]oxan-2-one |
|---|---|
| PubChem CID | 144557341 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | butanoic acid;6-[2-(2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl)ethyl]oxan-2-one |
| SMILES | CC1C=CC2=CCCCC2C1CCC1CCCC(=O)O1.CCCC(=O)O |
| InChI | InChI=1S/C18H26O2.C4H8O2/c1-13-9-10-14-5-2-3-7-17(14)16(13)12-11-15-6-4-8-18(19)20-15;1-2-3-4(5)6/h5,9-10,13,15-17H,2-4,6-8,11-12H2,1H3;2-3H2,1H3,(H,5,6) |
| InChIKey | VQJHSTPZKNWYSL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |