C17H27NOS — CID 144557829
(2S)-1-[(4E)-4-[(R)-methylsulfinyl]-3-propan-2-ylidenehexa-1,4-dien-2-yl]-2-prop-1-en-2-ylpyrrolidine (PubChem CID 144557829) has the molecular formula C17H27NOS and a molecular weight of 293.48 g/mol. Its IUPAC name is (2S)-1-[(4E)-4-[(R)-methylsulfinyl]-3-propan-2-ylidenehexa-1,4-dien-2-yl]-2-prop-1-en-2-ylpyrrolidine.
| Compound Name | (2S)-1-[(4E)-4-[(R)-methylsulfinyl]-3-propan-2-ylidenehexa-1,4-dien-2-yl]-2-prop-1-en-2-ylpyrrolidine |
|---|---|
| PubChem CID | 144557829 |
| Molecular Formula | C17H27NOS |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (2S)-1-[(4E)-4-[(R)-methylsulfinyl]-3-propan-2-ylidenehexa-1,4-dien-2-yl]-2-prop-1-en-2-ylpyrrolidine |
| SMILES | C=C(C)[C@@H]1CCCN1C(=C)C(=C(C)C)/C(=C\C)[S@@](C)=O |
| InChI | InChI=1S/C17H27NOS/c1-8-16(20(7)19)17(13(4)5)14(6)18-11-9-10-15(18)12(2)3/h8,15H,2,6,9-11H2,1,3-5,7H3/b16-8+/t15-,20+/m0/s1 |
| InChIKey | HJQOJPGNLRUREI-QLCAOTHQSA-N |
| XLogP | 4.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|