C23H17Cl2NO3 — CID 144558561
3-acetyl-4-(3,4-dichlorophenyl)-2-ethyl-1,4-dihydrobenzo[g]quinoline-5,10-dione (PubChem CID 144558561) has the molecular formula C23H17Cl2NO3 and a molecular weight of 426.30 g/mol. Its IUPAC name is 3-acetyl-4-(3,4-dichlorophenyl)-2-ethyl-1,4-dihydrobenzo[g]quinoline-5,10-dione.
| Compound Name | 3-acetyl-4-(3,4-dichlorophenyl)-2-ethyl-1,4-dihydrobenzo[g]quinoline-5,10-dione |
|---|---|
| PubChem CID | 144558561 |
| Molecular Formula | C23H17Cl2NO3 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 3-acetyl-4-(3,4-dichlorophenyl)-2-ethyl-1,4-dihydrobenzo[g]quinoline-5,10-dione |
| SMILES | CCC1=C(C(C)=O)C(c2ccc(Cl)c(Cl)c2)C2=C(N1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H17Cl2NO3/c1-3-17-18(11(2)27)19(12-8-9-15(24)16(25)10-12)20-21(26-17)23(29)14-7-5-4-6-13(14)22(20)28/h4-10,19,26H,3H2,1-2H3 |
| InChIKey | FEXVPZNLBMMMIR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|