C11H13F3N2O5S — CID 144558612
1-[2-[[(2S,4R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]-2,2,2-trifluoroethanone (PubChem CID 144558612) has the molecular formula C11H13F3N2O5S and a molecular weight of 342.30 g/mol. Its IUPAC name is 1-[2-[[(2S,4R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[2-[[(2S,4R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 144558612 |
| Molecular Formula | C11H13F3N2O5S |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 1-[2-[[(2S,4R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1cnc(N[C@@H]2C[C@@H](O)C(O)C(CO)O2)s1)C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O5S/c12-11(13,14)9(20)6-2-15-10(22-6)16-7-1-4(18)8(19)5(3-17)21-7/h2,4-5,7-8,17-19H,1,3H2,(H,15,16)/t4-,5?,7+,8?/m1/s1 |
| InChIKey | VUABPHDWTNBPMX-RCAXORGESA-N |
| XLogP | 0.13 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |