C21H32O — CID 144559252
(2E,4E)-6,6-dimethyl-5-[(E)-2-[(3E)-4-methylhexa-1,3,5-trien-3-yl]oxyprop-1-enyl]nona-2,4-diene (PubChem CID 144559252) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is (2E,4E)-6,6-dimethyl-5-[(E)-2-[(3E)-4-methylhexa-1,3,5-trien-3-yl]oxyprop-1-enyl]nona-2,4-diene.
| Compound Name | (2E,4E)-6,6-dimethyl-5-[(E)-2-[(3E)-4-methylhexa-1,3,5-trien-3-yl]oxyprop-1-enyl]nona-2,4-diene |
|---|---|
| PubChem CID | 144559252 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | (2E,4E)-6,6-dimethyl-5-[(E)-2-[(3E)-4-methylhexa-1,3,5-trien-3-yl]oxyprop-1-enyl]nona-2,4-diene |
| SMILES | C=C/C(C)=C(\C=C)O/C(C)=C/C(=C\C=C\C)C(C)(C)CCC |
| InChI | InChI=1S/C21H32O/c1-9-13-14-19(21(7,8)15-10-2)16-18(6)22-20(12-4)17(5)11-3/h9,11-14,16H,3-4,10,15H2,1-2,5-8H3/b13-9+,18-16+,19-14+,20-17+ |
| InChIKey | OUACGWVMUMKKBA-HOXMAWKMSA-N |
| XLogP | 6.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|