C17H25N — CID 144560051
3-ethyl-N-methyl-7-[2-(1-methylcyclopropyl)prop-2-enyl]cyclohepta-1,3,6-trien-1-amine (PubChem CID 144560051) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 3-ethyl-N-methyl-7-[2-(1-methylcyclopropyl)prop-2-enyl]cyclohepta-1,3,6-trien-1-amine.
| Compound Name | 3-ethyl-N-methyl-7-[2-(1-methylcyclopropyl)prop-2-enyl]cyclohepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 144560051 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 3-ethyl-N-methyl-7-[2-(1-methylcyclopropyl)prop-2-enyl]cyclohepta-1,3,6-trien-1-amine |
| SMILES | C=C(CC1=CCC=C(CC)C=C1NC)C1(C)CC1 |
| InChI | InChI=1S/C17H25N/c1-5-14-7-6-8-15(16(12-14)18-4)11-13(2)17(3)9-10-17/h7-8,12,18H,2,5-6,9-11H2,1,3-4H3 |
| InChIKey | DHLJKZTYWZGBBF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|