C13H7F5OS — CID 144560588
2,3,5,6-tetrafluoro-4-[4-(fluoromethyl)phenoxy]benzenethiol (PubChem CID 144560588) has the molecular formula C13H7F5OS and a molecular weight of 306.26 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[4-(fluoromethyl)phenoxy]benzenethiol.
| Compound Name | 2,3,5,6-tetrafluoro-4-[4-(fluoromethyl)phenoxy]benzenethiol |
|---|---|
| PubChem CID | 144560588 |
| Molecular Formula | C13H7F5OS |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[4-(fluoromethyl)phenoxy]benzenethiol |
| SMILES | FCc1ccc(Oc2c(F)c(F)c(S)c(F)c2F)cc1 |
| InChI | InChI=1S/C13H7F5OS/c14-5-6-1-3-7(4-2-6)19-12-8(15)10(17)13(20)11(18)9(12)16/h1-4,20H,5H2 |
| InChIKey | JKYSQPYPAROVTF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|