About diphenylsulfanium;(2Z,4Z)-hepta-2,4-diene
diphenylsulfanium;(2Z,4Z)-hepta-2,4-diene (PubChem CID 144560706) has the molecular formula C19H23S+
and a molecular weight of 283.46 g/mol. Its IUPAC name is diphenylsulfanium;(2Z,4Z)-hepta-2,4-diene.
Molecular Properties
| Compound Name | diphenylsulfanium;(2Z,4Z)-hepta-2,4-diene |
| PubChem CID | 144560706 |
| Molecular Formula | C19H23S+ |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | diphenylsulfanium;(2Z,4Z)-hepta-2,4-diene |
| SMILES | C/C=C\C=C/CC.c1ccc([SH+]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S.C7H12/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-5-7-6-4-2/h1-10H;3,5-7H,4H2,1-2H3/p+1/b;5-3-,7-6- |
| InChIKey | CUVBUAOLIGDIKZ-CUBYKCRCSA-O |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze diphenylsulfanium;(2Z,4Z)-hepta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylsulfanium;(2Z,4Z)-hepta-2,4-diene?
The IUPAC name of diphenylsulfanium;(2Z,4Z)-hepta-2,4-diene (CID 144560706) is diphenylsulfanium;(2Z,4Z)-hepta-2,4-diene.
What is the SMILES notation for diphenylsulfanium;(2Z,4Z)-hepta-2,4-diene?
The canonical SMILES for diphenylsulfanium;(2Z,4Z)-hepta-2,4-diene is C/C=C\C=C/CC.c1ccc([SH+]c2ccccc2)cc1.
What is the InChIKey of diphenylsulfanium;(2Z,4Z)-hepta-2,4-diene?
The InChIKey is CUVBUAOLIGDIKZ-CUBYKCRCSA-O. The full InChI is InChI=1S/C12H10S.C7H12/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-5-7-6-4-2/h1-10H;3,5-7H,4H2,1-2H3/p+1/b;5-3-,7-6-.
What are the key properties of diphenylsulfanium;(2Z,4Z)-hepta-2,4-diene?
diphenylsulfanium;(2Z,4Z)-hepta-2,4-diene has a molecular weight of 283.46 g/mol, XLogP of 5.45, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylsulfanium;(2Z,4Z)-hepta-2,4-diene is sourced from PubChem (CID 144560706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).