C16H34N2O4 — CID 144560794
butanenitrile;2-[3-[2-(2-hydroxyethoxy)ethyl-propylamino]propoxy]ethanol (PubChem CID 144560794) has the molecular formula C16H34N2O4 and a molecular weight of 318.46 g/mol. Its IUPAC name is butanenitrile;2-[3-[2-(2-hydroxyethoxy)ethyl-propylamino]propoxy]ethanol.
| Compound Name | butanenitrile;2-[3-[2-(2-hydroxyethoxy)ethyl-propylamino]propoxy]ethanol |
|---|---|
| PubChem CID | 144560794 |
| Molecular Formula | C16H34N2O4 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | butanenitrile;2-[3-[2-(2-hydroxyethoxy)ethyl-propylamino]propoxy]ethanol |
| SMILES | CCCC#N.CCCN(CCCOCCO)CCOCCO |
| InChI | InChI=1S/C12H27NO4.C4H7N/c1-2-4-13(6-10-17-12-8-15)5-3-9-16-11-7-14;1-2-3-4-5/h14-15H,2-12H2,1H3;2-3H2,1H3 |
| InChIKey | KEZRRHVRPAVHEU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|