C48H57F6O5S3+ — CID 144560835
1,3,5-tricyclohexyl-2-(1,1,2,2,3,3-hexafluoro-3-hydroxysulfanylpropyl)sulfanyloxybenzene;tris(3-methoxyphenyl)sulfanium (PubChem CID 144560835) has the molecular formula C48H57F6O5S3+ and a molecular weight of 924.17 g/mol. Its IUPAC name is 1,3,5-tricyclohexyl-2-(1,1,2,2,3,3-hexafluoro-3-hydroxysulfanylpropyl)sulfanyloxybenzene;tris(3-methoxyphenyl)sulfanium.
| Compound Name | 1,3,5-tricyclohexyl-2-(1,1,2,2,3,3-hexafluoro-3-hydroxysulfanylpropyl)sulfanyloxybenzene;tris(3-methoxyphenyl)sulfanium |
|---|---|
| PubChem CID | 144560835 |
| Molecular Formula | C48H57F6O5S3+ |
| Molecular Weight | 924.17 g/mol |
| Exact Mass | 923.33 |
| IUPAC Name | 1,3,5-tricyclohexyl-2-(1,1,2,2,3,3-hexafluoro-3-hydroxysulfanylpropyl)sulfanyloxybenzene;tris(3-methoxyphenyl)sulfanium |
| SMILES | COc1cccc([S+](c2cccc(OC)c2)c2cccc(OC)c2)c1.OSC(F)(F)C(F)(F)C(F)(F)SOc1c(C2CCCCC2)cc(C2CCCCC2)cc1C1CCCCC1 |
| InChI | InChI=1S/C27H36F6O2S2.C21H21O3S/c28-25(29,26(30,31)36-34)27(32,33)37-35-24-22(19-12-6-2-7-13-19)16-21(18-10-4-1-5-11-18)17-23(24)20-14-8-3-9-15-20;1-22-16-7-4-10-19(13-16)25(20-11-5-8-17(14-20)23-2)21-12-6-9-18(15-21)24-3/h16-20,34H,1-15H2;4-15H,1-3H3/q;+1 |
| InChIKey | WHONILPYRYUNKV-UHFFFAOYSA-N |
| XLogP | 15.69 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.17 |
| LogP ≤ 5 | 15.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|