C41H51N3O7 — CID 144561241
N-[2-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethoxy]ethyl]-2-methoxy-N-(2-methoxyethyl)ethanamine;2,4,5-triphenyl-1H-imidazole (PubChem CID 144561241) has the molecular formula C41H51N3O7 and a molecular weight of 697.87 g/mol. Its IUPAC name is N-[2-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethoxy]ethyl]-2-methoxy-N-(2-methoxyethyl)ethanamine;2,4,5-triphenyl-1H-imidazole.
| Compound Name | N-[2-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethoxy]ethyl]-2-methoxy-N-(2-methoxyethyl)ethanamine;2,4,5-triphenyl-1H-imidazole |
|---|---|
| PubChem CID | 144561241 |
| Molecular Formula | C41H51N3O7 |
| Molecular Weight | 697.87 g/mol |
| Exact Mass | 697.37 |
| IUPAC Name | N-[2-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethoxy]ethyl]-2-methoxy-N-(2-methoxyethyl)ethanamine;2,4,5-triphenyl-1H-imidazole |
| SMILES | COCCN(CCOC)CCOCCOCCOc1c(OC)cccc1OC.c1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C21H16N2.C20H35NO7/c1-4-10-16(11-5-1)19-20(17-12-6-2-7-13-17)23-21(22-19)18-14-8-3-9-15-18;1-22-11-8-21(9-12-23-2)10-13-26-14-15-27-16-17-28-20-18(24-3)6-5-7-19(20)25-4/h1-15H,(H,22,23);5-7H,8-17H2,1-4H3 |
| InChIKey | ONDFVSFYGUFKOI-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.87 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|