About 3-cyclohexylpentan-3-yl 2-aminobutanoate
3-cyclohexylpentan-3-yl 2-aminobutanoate (PubChem CID 144561282) has the molecular formula C15H29NO2
and a molecular weight of 255.40 g/mol. Its IUPAC name is 3-cyclohexylpentan-3-yl 2-aminobutanoate.
Molecular Properties
| Compound Name | 3-cyclohexylpentan-3-yl 2-aminobutanoate |
| PubChem CID | 144561282 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 3-cyclohexylpentan-3-yl 2-aminobutanoate |
| SMILES | CCC(N)C(=O)OC(CC)(CC)C1CCCCC1 |
| InChI | InChI=1S/C15H29NO2/c1-4-13(16)14(17)18-15(5-2,6-3)12-10-8-7-9-11-12/h12-13H,4-11,16H2,1-3H3 |
| InChIKey | LORGMFUZBJMOGS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclohexylpentan-3-yl 2-aminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylpentan-3-yl 2-aminobutanoate?
The IUPAC name of 3-cyclohexylpentan-3-yl 2-aminobutanoate (CID 144561282) is 3-cyclohexylpentan-3-yl 2-aminobutanoate.
What is the SMILES notation for 3-cyclohexylpentan-3-yl 2-aminobutanoate?
The canonical SMILES for 3-cyclohexylpentan-3-yl 2-aminobutanoate is CCC(N)C(=O)OC(CC)(CC)C1CCCCC1.
What is the InChIKey of 3-cyclohexylpentan-3-yl 2-aminobutanoate?
The InChIKey is LORGMFUZBJMOGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO2/c1-4-13(16)14(17)18-15(5-2,6-3)12-10-8-7-9-11-12/h12-13H,4-11,16H2,1-3H3.
What are the key properties of 3-cyclohexylpentan-3-yl 2-aminobutanoate?
3-cyclohexylpentan-3-yl 2-aminobutanoate has a molecular weight of 255.40 g/mol, XLogP of 3.41, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylpentan-3-yl 2-aminobutanoate is sourced from PubChem (CID 144561282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).