About 2-fluoro-4-methyl-1,3-dihydrotriazole
2-fluoro-4-methyl-1,3-dihydrotriazole (PubChem CID 144561664) has the molecular formula C3H6FN3
and a molecular weight of 103.10 g/mol. Its IUPAC name is 2-fluoro-4-methyl-1,3-dihydrotriazole.
Molecular Properties
| Compound Name | 2-fluoro-4-methyl-1,3-dihydrotriazole |
| PubChem CID | 144561664 |
| Molecular Formula | C3H6FN3 |
| Molecular Weight | 103.10 g/mol |
| Exact Mass | 103.05 |
| IUPAC Name | 2-fluoro-4-methyl-1,3-dihydrotriazole |
| SMILES | CC1=CNN(F)N1 |
| InChI | InChI=1S/C3H6FN3/c1-3-2-5-7(4)6-3/h2,5-6H,1H3 |
| InChIKey | DLHLUCOVGBHGCL-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.10 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4-methyl-1,3-dihydrotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-methyl-1,3-dihydrotriazole?
The IUPAC name of 2-fluoro-4-methyl-1,3-dihydrotriazole (CID 144561664) is 2-fluoro-4-methyl-1,3-dihydrotriazole.
What is the SMILES notation for 2-fluoro-4-methyl-1,3-dihydrotriazole?
The canonical SMILES for 2-fluoro-4-methyl-1,3-dihydrotriazole is CC1=CNN(F)N1.
What is the InChIKey of 2-fluoro-4-methyl-1,3-dihydrotriazole?
The InChIKey is DLHLUCOVGBHGCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6FN3/c1-3-2-5-7(4)6-3/h2,5-6H,1H3.
What are the key properties of 2-fluoro-4-methyl-1,3-dihydrotriazole?
2-fluoro-4-methyl-1,3-dihydrotriazole has a molecular weight of 103.10 g/mol, XLogP of 0.06, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-methyl-1,3-dihydrotriazole is sourced from PubChem (CID 144561664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).