About 3-[amino-[3-(dimethylamino)propyl]amino]-2H-1,2,4-oxadiazole-5-thione;ethane
3-[amino-[3-(dimethylamino)propyl]amino]-2H-1,2,4-oxadiazole-5-thione;ethane (PubChem CID 144561719) has the molecular formula C9H21N5OS
and a molecular weight of 247.37 g/mol. Its IUPAC name is 3-[amino-[3-(dimethylamino)propyl]amino]-2H-1,2,4-oxadiazole-5-thione;ethane.
Molecular Properties
| Compound Name | 3-[amino-[3-(dimethylamino)propyl]amino]-2H-1,2,4-oxadiazole-5-thione;ethane |
| PubChem CID | 144561719 |
| Molecular Formula | C9H21N5OS |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 3-[amino-[3-(dimethylamino)propyl]amino]-2H-1,2,4-oxadiazole-5-thione;ethane |
| SMILES | CC.CN(C)CCCN(N)c1nc(=S)o[nH]1 |
| InChI | InChI=1S/C7H15N5OS.C2H6/c1-11(2)4-3-5-12(8)6-9-7(14)13-10-6;1-2/h3-5,8H2,1-2H3,(H,9,10,14);1-2H3 |
| InChIKey | YAVSUIBPCAVHDI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[amino-[3-(dimethylamino)propyl]amino]-2H-1,2,4-oxadiazole-5-thione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[amino-[3-(dimethylamino)propyl]amino]-2H-1,2,4-oxadiazole-5-thione;ethane?
The IUPAC name of 3-[amino-[3-(dimethylamino)propyl]amino]-2H-1,2,4-oxadiazole-5-thione;ethane (CID 144561719) is 3-[amino-[3-(dimethylamino)propyl]amino]-2H-1,2,4-oxadiazole-5-thione;ethane.
What is the SMILES notation for 3-[amino-[3-(dimethylamino)propyl]amino]-2H-1,2,4-oxadiazole-5-thione;ethane?
The canonical SMILES for 3-[amino-[3-(dimethylamino)propyl]amino]-2H-1,2,4-oxadiazole-5-thione;ethane is CC.CN(C)CCCN(N)c1nc(=S)o[nH]1.
What is the InChIKey of 3-[amino-[3-(dimethylamino)propyl]amino]-2H-1,2,4-oxadiazole-5-thione;ethane?
The InChIKey is YAVSUIBPCAVHDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N5OS.C2H6/c1-11(2)4-3-5-12(8)6-9-7(14)13-10-6;1-2/h3-5,8H2,1-2H3,(H,9,10,14);1-2H3.
What are the key properties of 3-[amino-[3-(dimethylamino)propyl]amino]-2H-1,2,4-oxadiazole-5-thione;ethane?
3-[amino-[3-(dimethylamino)propyl]amino]-2H-1,2,4-oxadiazole-5-thione;ethane has a molecular weight of 247.37 g/mol, XLogP of 1.39, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[amino-[3-(dimethylamino)propyl]amino]-2H-1,2,4-oxadiazole-5-thione;ethane is sourced from PubChem (CID 144561719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).