About ethane;1-(3-methoxypropyl)-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine
ethane;1-(3-methoxypropyl)-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine (PubChem CID 144561783) has the molecular formula C9H18F3N5O
and a molecular weight of 269.27 g/mol. Its IUPAC name is ethane;1-(3-methoxypropyl)-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine.
Molecular Properties
| Compound Name | ethane;1-(3-methoxypropyl)-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine |
| PubChem CID | 144561783 |
| Molecular Formula | C9H18F3N5O |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | ethane;1-(3-methoxypropyl)-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine |
| SMILES | CC.COCCCN(N)c1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C7H12F3N5O.C2H6/c1-16-4-2-3-15(11)6-12-5(13-14-6)7(8,9)10;1-2/h2-4,11H2,1H3,(H,12,13,14);1-2H3 |
| InChIKey | MOUZVMFPFZYSIL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(3-methoxypropyl)-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(3-methoxypropyl)-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine?
The IUPAC name of ethane;1-(3-methoxypropyl)-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine (CID 144561783) is ethane;1-(3-methoxypropyl)-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine.
What is the SMILES notation for ethane;1-(3-methoxypropyl)-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine?
The canonical SMILES for ethane;1-(3-methoxypropyl)-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine is CC.COCCCN(N)c1n[nH]c(C(F)(F)F)n1.
What is the InChIKey of ethane;1-(3-methoxypropyl)-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine?
The InChIKey is MOUZVMFPFZYSIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F3N5O.C2H6/c1-16-4-2-3-15(11)6-12-5(13-14-6)7(8,9)10;1-2/h2-4,11H2,1H3,(H,12,13,14);1-2H3.
What are the key properties of ethane;1-(3-methoxypropyl)-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine?
ethane;1-(3-methoxypropyl)-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine has a molecular weight of 269.27 g/mol, XLogP of 1.57, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(3-methoxypropyl)-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine is sourced from PubChem (CID 144561783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).