(Z)-2-hydrazinylprop-1-en-1-amine;molecular hydrogen

C3H11N3 — CID 144561883

IUPAC(Z)-2-hydrazinylprop-1-en-1-amine;molecular hydrogen
SMILESC/C(=C/N)NN.[H][H]
InChIInChI=1S/C3H9N3.H2/c1-3(2-4)6-5;/h2,6H,4-5H2,1H3;1H/b3-2-;
InChIKeyOOGZVTJQHNKXMA-OLGQORCHSA-N
MW89.14 g/mol
LogP-0.48
Rot. Bonds1

About (Z)-2-hydrazinylprop-1-en-1-amine;molecular hydrogen

(Z)-2-hydrazinylprop-1-en-1-amine;molecular hydrogen (PubChem CID 144561883) has the molecular formula C3H11N3 and a molecular weight of 89.14 g/mol. Its IUPAC name is (Z)-2-hydrazinylprop-1-en-1-amine;molecular hydrogen.

Molecular Properties

Compound Name(Z)-2-hydrazinylprop-1-en-1-amine;molecular hydrogen
PubChem CID144561883
Molecular FormulaC3H11N3
Molecular Weight89.14 g/mol
Exact Mass89.10
IUPAC Name(Z)-2-hydrazinylprop-1-en-1-amine;molecular hydrogen
SMILESC/C(=C/N)NN.[H][H]
InChIInChI=1S/C3H9N3.H2/c1-3(2-4)6-5;/h2,6H,4-5H2,1H3;1H/b3-2-;
InChIKeyOOGZVTJQHNKXMA-OLGQORCHSA-N
XLogP-0.48
TPSA64.07 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50089.14
LogP ≤ 5-0.48
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (Z)-2-hydrazinylprop-1-en-1-amine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-2-hydrazinylprop-1-en-1-amine;molecular hydrogen?
The IUPAC name of (Z)-2-hydrazinylprop-1-en-1-amine;molecular hydrogen (CID 144561883) is (Z)-2-hydrazinylprop-1-en-1-amine;molecular hydrogen.
What is the SMILES notation for (Z)-2-hydrazinylprop-1-en-1-amine;molecular hydrogen?
The canonical SMILES for (Z)-2-hydrazinylprop-1-en-1-amine;molecular hydrogen is C/C(=C/N)NN.[H][H].
What is the InChIKey of (Z)-2-hydrazinylprop-1-en-1-amine;molecular hydrogen?
The InChIKey is OOGZVTJQHNKXMA-OLGQORCHSA-N. The full InChI is InChI=1S/C3H9N3.H2/c1-3(2-4)6-5;/h2,6H,4-5H2,1H3;1H/b3-2-;.
What are the key properties of (Z)-2-hydrazinylprop-1-en-1-amine;molecular hydrogen?
(Z)-2-hydrazinylprop-1-en-1-amine;molecular hydrogen has a molecular weight of 89.14 g/mol, XLogP of -0.48, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-hydrazinylprop-1-en-1-amine;molecular hydrogen is sourced from PubChem (CID 144561883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).