About 5-but-3-ynyl-1,3-thiazolidine-2,4-dione
5-but-3-ynyl-1,3-thiazolidine-2,4-dione (PubChem CID 144561886) has the molecular formula C7H7NO2S
and a molecular weight of 169.20 g/mol. Its IUPAC name is 5-but-3-ynyl-1,3-thiazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-but-3-ynyl-1,3-thiazolidine-2,4-dione |
| PubChem CID | 144561886 |
| Molecular Formula | C7H7NO2S |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.02 |
| IUPAC Name | 5-but-3-ynyl-1,3-thiazolidine-2,4-dione |
| SMILES | C#CCCC1SC(=O)NC1=O |
| InChI | InChI=1S/C7H7NO2S/c1-2-3-4-5-6(9)8-7(10)11-5/h1,5H,3-4H2,(H,8,9,10) |
| InChIKey | ZNWMEQSSCIUWQK-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-but-3-ynyl-1,3-thiazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-but-3-ynyl-1,3-thiazolidine-2,4-dione?
The IUPAC name of 5-but-3-ynyl-1,3-thiazolidine-2,4-dione (CID 144561886) is 5-but-3-ynyl-1,3-thiazolidine-2,4-dione.
What is the SMILES notation for 5-but-3-ynyl-1,3-thiazolidine-2,4-dione?
The canonical SMILES for 5-but-3-ynyl-1,3-thiazolidine-2,4-dione is C#CCCC1SC(=O)NC1=O.
What is the InChIKey of 5-but-3-ynyl-1,3-thiazolidine-2,4-dione?
The InChIKey is ZNWMEQSSCIUWQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2S/c1-2-3-4-5-6(9)8-7(10)11-5/h1,5H,3-4H2,(H,8,9,10).
What are the key properties of 5-but-3-ynyl-1,3-thiazolidine-2,4-dione?
5-but-3-ynyl-1,3-thiazolidine-2,4-dione has a molecular weight of 169.20 g/mol, XLogP of 0.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-but-3-ynyl-1,3-thiazolidine-2,4-dione is sourced from PubChem (CID 144561886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).