C14H28O2 — CID 144561951
2-methylbutane;(1R,4R,5R,8R)-1,4,8-trimethyl-2,7-dioxabicyclo[3.2.1]octane (PubChem CID 144561951) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 2-methylbutane;(1R,4R,5R,8R)-1,4,8-trimethyl-2,7-dioxabicyclo[3.2.1]octane.
| Compound Name | 2-methylbutane;(1R,4R,5R,8R)-1,4,8-trimethyl-2,7-dioxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 144561951 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 2-methylbutane;(1R,4R,5R,8R)-1,4,8-trimethyl-2,7-dioxabicyclo[3.2.1]octane |
| SMILES | CCC(C)C.C[C@@H]1[C@@H]2CO[C@@]1(C)OC[C@@H]2C |
| InChI | InChI=1S/C9H16O2.C5H12/c1-6-4-10-9(3)7(2)8(6)5-11-9;1-4-5(2)3/h6-8H,4-5H2,1-3H3;5H,4H2,1-3H3/t6-,7+,8+,9+;/m0./s1 |
| InChIKey | RRWLJLHEJZVLTF-WWTDWBKBSA-N |
| XLogP | 3.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |