C29H41NO3 — CID 144562450
1-[[6-(4,4-dimethylcyclohexyl)oxynaphthalen-2-yl]methyl]-3-(3-methylperoxycyclohexyl)azetidine (PubChem CID 144562450) has the molecular formula C29H41NO3 and a molecular weight of 451.65 g/mol. Its IUPAC name is 1-[[6-(4,4-dimethylcyclohexyl)oxynaphthalen-2-yl]methyl]-3-(3-methylperoxycyclohexyl)azetidine.
| Compound Name | 1-[[6-(4,4-dimethylcyclohexyl)oxynaphthalen-2-yl]methyl]-3-(3-methylperoxycyclohexyl)azetidine |
|---|---|
| PubChem CID | 144562450 |
| Molecular Formula | C29H41NO3 |
| Molecular Weight | 451.65 g/mol |
| Exact Mass | 451.31 |
| IUPAC Name | 1-[[6-(4,4-dimethylcyclohexyl)oxynaphthalen-2-yl]methyl]-3-(3-methylperoxycyclohexyl)azetidine |
| SMILES | COOC1CCCC(C2CN(Cc3ccc4cc(OC5CCC(C)(C)CC5)ccc4c3)C2)C1 |
| InChI | InChI=1S/C29H41NO3/c1-29(2)13-11-26(12-14-29)32-27-10-9-23-15-21(7-8-24(23)16-27)18-30-19-25(20-30)22-5-4-6-28(17-22)33-31-3/h7-10,15-16,22,25-26,28H,4-6,11-14,17-20H2,1-3H3 |
| InChIKey | HSIPEEHVZRMRJI-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.65 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|