C23H14O3 — CID 144562614
12-methyl-10-methylidenepentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14,16,18-octaene-3,20,21-trione (PubChem CID 144562614) has the molecular formula C23H14O3 and a molecular weight of 338.36 g/mol. Its IUPAC name is 12-methyl-10-methylidenepentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14,16,18-octaene-3,20,21-trione.
| Compound Name | 12-methyl-10-methylidenepentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14,16,18-octaene-3,20,21-trione |
|---|---|
| PubChem CID | 144562614 |
| Molecular Formula | C23H14O3 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 12-methyl-10-methylidenepentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14,16,18-octaene-3,20,21-trione |
| SMILES | C=C1C2=C(C(=O)c3ccccc31)C1=C(c3ccccc3C(=O)C1=O)C2C |
| InChI | InChI=1S/C23H14O3/c1-11-13-7-3-5-9-15(13)21(24)19-17(11)12(2)18-14-8-4-6-10-16(14)22(25)23(26)20(18)19/h3-10,12H,1H2,2H3 |
| InChIKey | PTNHODNNZFAYHB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|