C28H36N2O3 — CID 1445629
(1R,2S,5S,6R,7S)-3-(cyclohexylmethyl)-N-cyclopentyl-6-(4-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2-carboxamide (PubChem CID 1445629) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is (1R,2S,5S,6R,7S)-3-(cyclohexylmethyl)-N-cyclopentyl-6-(4-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2-carboxamide.
| Compound Name | (1R,2S,5S,6R,7S)-3-(cyclohexylmethyl)-N-cyclopentyl-6-(4-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2-carboxamide |
|---|---|
| PubChem CID | 1445629 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | (1R,2S,5S,6R,7S)-3-(cyclohexylmethyl)-N-cyclopentyl-6-(4-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2-carboxamide |
| SMILES | Cc1ccc([C@@H]2[C@@H]3C=C[C@@]4(O3)[C@H]2C(=O)N(CC2CCCCC2)[C@@H]4C(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C28H36N2O3/c1-18-11-13-20(14-12-18)23-22-15-16-28(33-22)24(23)27(32)30(17-19-7-3-2-4-8-19)25(28)26(31)29-21-9-5-6-10-21/h11-16,19,21-25H,2-10,17H2,1H3,(H,29,31)/t22-,23+,24+,25+,28+/m0/s1 |
| InChIKey | FQIDKPSCQYBSCJ-QLZFCUCYSA-N |
| XLogP | 4.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|