About 4,5-dimethyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole;ethane
4,5-dimethyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole;ethane (PubChem CID 144563237) has the molecular formula C18H39N3
and a molecular weight of 297.53 g/mol. Its IUPAC name is 4,5-dimethyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole;ethane.
Molecular Properties
| Compound Name | 4,5-dimethyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole;ethane |
| PubChem CID | 144563237 |
| Molecular Formula | C18H39N3 |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.31 |
| IUPAC Name | 4,5-dimethyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole;ethane |
| SMILES | CC.CC.CC.CC.CC1=CC(c2nc(C)c(C)[nH]2)NC1 |
| InChI | InChI=1S/C10H15N3.4C2H6/c1-6-4-9(11-5-6)10-12-7(2)8(3)13-10;4*1-2/h4,9,11H,5H2,1-3H3,(H,12,13);4*1-2H3 |
| InChIKey | BFAXWCWWIBIMGX-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole;ethane?
The IUPAC name of 4,5-dimethyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole;ethane (CID 144563237) is 4,5-dimethyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole;ethane.
What is the SMILES notation for 4,5-dimethyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole;ethane?
The canonical SMILES for 4,5-dimethyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole;ethane is CC.CC.CC.CC.CC1=CC(c2nc(C)c(C)[nH]2)NC1.
What is the InChIKey of 4,5-dimethyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole;ethane?
The InChIKey is BFAXWCWWIBIMGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3.4C2H6/c1-6-4-9(11-5-6)10-12-7(2)8(3)13-10;4*1-2/h4,9,11H,5H2,1-3H3,(H,12,13);4*1-2H3.
What are the key properties of 4,5-dimethyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole;ethane?
4,5-dimethyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole;ethane has a molecular weight of 297.53 g/mol, XLogP of 5.72, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2-(4-methyl-2,5-dihydro-1H-pyrrol-2-yl)-1H-imidazole;ethane is sourced from PubChem (CID 144563237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).