About 7-tert-butyl-4-(2-tert-butyl-1H-imidazol-5-yl)-1,3-benzoxazole;molecular hydrogen
7-tert-butyl-4-(2-tert-butyl-1H-imidazol-5-yl)-1,3-benzoxazole;molecular hydrogen (PubChem CID 144563711) has the molecular formula C18H25N3O
and a molecular weight of 299.42 g/mol. Its IUPAC name is 7-tert-butyl-4-(2-tert-butyl-1H-imidazol-5-yl)-1,3-benzoxazole;molecular hydrogen.
Molecular Properties
| Compound Name | 7-tert-butyl-4-(2-tert-butyl-1H-imidazol-5-yl)-1,3-benzoxazole;molecular hydrogen |
| PubChem CID | 144563711 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 7-tert-butyl-4-(2-tert-butyl-1H-imidazol-5-yl)-1,3-benzoxazole;molecular hydrogen |
| SMILES | CC(C)(C)c1ncc(-c2ccc(C(C)(C)C)c3ocnc23)[nH]1.[H][H] |
| InChI | InChI=1S/C18H23N3O.H2/c1-17(2,3)12-8-7-11(14-15(12)22-10-20-14)13-9-19-16(21-13)18(4,5)6;/h7-10H,1-6H3,(H,19,21);1H |
| InChIKey | CUJBFXIFCYKHSD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-tert-butyl-4-(2-tert-butyl-1H-imidazol-5-yl)-1,3-benzoxazole;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-4-(2-tert-butyl-1H-imidazol-5-yl)-1,3-benzoxazole;molecular hydrogen?
The IUPAC name of 7-tert-butyl-4-(2-tert-butyl-1H-imidazol-5-yl)-1,3-benzoxazole;molecular hydrogen (CID 144563711) is 7-tert-butyl-4-(2-tert-butyl-1H-imidazol-5-yl)-1,3-benzoxazole;molecular hydrogen.
What is the SMILES notation for 7-tert-butyl-4-(2-tert-butyl-1H-imidazol-5-yl)-1,3-benzoxazole;molecular hydrogen?
The canonical SMILES for 7-tert-butyl-4-(2-tert-butyl-1H-imidazol-5-yl)-1,3-benzoxazole;molecular hydrogen is CC(C)(C)c1ncc(-c2ccc(C(C)(C)C)c3ocnc23)[nH]1.[H][H].
What is the InChIKey of 7-tert-butyl-4-(2-tert-butyl-1H-imidazol-5-yl)-1,3-benzoxazole;molecular hydrogen?
The InChIKey is CUJBFXIFCYKHSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O.H2/c1-17(2,3)12-8-7-11(14-15(12)22-10-20-14)13-9-19-16(21-13)18(4,5)6;/h7-10H,1-6H3,(H,19,21);1H.
What are the key properties of 7-tert-butyl-4-(2-tert-butyl-1H-imidazol-5-yl)-1,3-benzoxazole;molecular hydrogen?
7-tert-butyl-4-(2-tert-butyl-1H-imidazol-5-yl)-1,3-benzoxazole;molecular hydrogen has a molecular weight of 299.42 g/mol, XLogP of 5.06, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-4-(2-tert-butyl-1H-imidazol-5-yl)-1,3-benzoxazole;molecular hydrogen is sourced from PubChem (CID 144563711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).