About 6-ethyl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine
6-ethyl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine (PubChem CID 144563742) has the molecular formula C8H13F3N4
and a molecular weight of 222.21 g/mol. Its IUPAC name is 6-ethyl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine.
Molecular Properties
| Compound Name | 6-ethyl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine |
| PubChem CID | 144563742 |
| Molecular Formula | C8H13F3N4 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 6-ethyl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine |
| SMILES | [H]/N=C1\CNCC(CC)N1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C8H13F3N4/c1-2-5-3-14-4-6(12)15(5)7(13)8(9,10)11/h5,12-14H,2-4H2,1H3/b12-6+,13-7+ |
| InChIKey | HZQSZIOROGKKAO-PWHKKFIBSA-N |
| XLogP | 1.19 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine?
The IUPAC name of 6-ethyl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine (CID 144563742) is 6-ethyl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine.
What is the SMILES notation for 6-ethyl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine?
The canonical SMILES for 6-ethyl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine is [H]/N=C1\CNCC(CC)N1/C(=N/[H])C(F)(F)F.
What is the InChIKey of 6-ethyl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine?
The InChIKey is HZQSZIOROGKKAO-PWHKKFIBSA-N. The full InChI is InChI=1S/C8H13F3N4/c1-2-5-3-14-4-6(12)15(5)7(13)8(9,10)11/h5,12-14H,2-4H2,1H3/b12-6+,13-7+.
What are the key properties of 6-ethyl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine?
6-ethyl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine has a molecular weight of 222.21 g/mol, XLogP of 1.19, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine is sourced from PubChem (CID 144563742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).