C9H12F6N4 — CID 144563768
6-methyl-1-(2,2,2-trifluoroethanimidoyl)-3-(2,2,2-trifluoroethyl)piperazin-2-imine (PubChem CID 144563768) has the molecular formula C9H12F6N4 and a molecular weight of 290.21 g/mol. Its IUPAC name is 6-methyl-1-(2,2,2-trifluoroethanimidoyl)-3-(2,2,2-trifluoroethyl)piperazin-2-imine.
| Compound Name | 6-methyl-1-(2,2,2-trifluoroethanimidoyl)-3-(2,2,2-trifluoroethyl)piperazin-2-imine |
|---|---|
| PubChem CID | 144563768 |
| Molecular Formula | C9H12F6N4 |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 6-methyl-1-(2,2,2-trifluoroethanimidoyl)-3-(2,2,2-trifluoroethyl)piperazin-2-imine |
| SMILES | [H]/N=C1\C(CC(F)(F)F)NCC(C)N1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C9H12F6N4/c1-4-3-18-5(2-8(10,11)12)6(16)19(4)7(17)9(13,14)15/h4-5,16-18H,2-3H2,1H3/b16-6+,17-7+ |
| InChIKey | ZPZYTOBXOOASOV-KGMKFKQSSA-N |
| XLogP | 2.12 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|