C24H24ClNO6 — CID 144564128
(5R,6R)-6-(3-chloro-2-hydroxy-4,6-dimethoxybenzoyl)-5-methyl-3-(phenacylamino)cyclohex-2-en-1-one (PubChem CID 144564128) has the molecular formula C24H24ClNO6 and a molecular weight of 457.91 g/mol. Its IUPAC name is (5R,6R)-6-(3-chloro-2-hydroxy-4,6-dimethoxybenzoyl)-5-methyl-3-(phenacylamino)cyclohex-2-en-1-one.
| Compound Name | (5R,6R)-6-(3-chloro-2-hydroxy-4,6-dimethoxybenzoyl)-5-methyl-3-(phenacylamino)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 144564128 |
| Molecular Formula | C24H24ClNO6 |
| Molecular Weight | 457.91 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | (5R,6R)-6-(3-chloro-2-hydroxy-4,6-dimethoxybenzoyl)-5-methyl-3-(phenacylamino)cyclohex-2-en-1-one |
| SMILES | COc1cc(OC)c(C(=O)[C@H]2C(=O)C=C(NCC(=O)c3ccccc3)C[C@H]2C)c(O)c1Cl |
| InChI | InChI=1S/C24H24ClNO6/c1-13-9-15(26-12-17(28)14-7-5-4-6-8-14)10-16(27)20(13)23(29)21-18(31-2)11-19(32-3)22(25)24(21)30/h4-8,10-11,13,20,26,30H,9,12H2,1-3H3/t13-,20-/m1/s1 |
| InChIKey | KVTNAFZOPSYMNY-ZUOKHONESA-N |
| XLogP | 3.83 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.91 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|