C31H40N4O2 — CID 144564483
1-[(1R,5S)-9-[(3R,5S,7R)-1,7-dimethyl-3-bicyclo[3.2.1]octanyl]-9-azabicyclo[3.3.1]nonan-3-yl]-3-(6-oxo-1H-pyridin-2-yl)quinoxalin-2-one;molecular hydrogen (PubChem CID 144564483) has the molecular formula C31H40N4O2 and a molecular weight of 500.69 g/mol. Its IUPAC name is 1-[(1R,5S)-9-[(3R,5S,7R)-1,7-dimethyl-3-bicyclo[3.2.1]octanyl]-9-azabicyclo[3.3.1]nonan-3-yl]-3-(6-oxo-1H-pyridin-2-yl)quinoxalin-2-one;molecular hydrogen.
| Compound Name | 1-[(1R,5S)-9-[(3R,5S,7R)-1,7-dimethyl-3-bicyclo[3.2.1]octanyl]-9-azabicyclo[3.3.1]nonan-3-yl]-3-(6-oxo-1H-pyridin-2-yl)quinoxalin-2-one;molecular hydrogen |
|---|---|
| PubChem CID | 144564483 |
| Molecular Formula | C31H40N4O2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | 1-[(1R,5S)-9-[(3R,5S,7R)-1,7-dimethyl-3-bicyclo[3.2.1]octanyl]-9-azabicyclo[3.3.1]nonan-3-yl]-3-(6-oxo-1H-pyridin-2-yl)quinoxalin-2-one;molecular hydrogen |
| SMILES | C[C@@H]1C[C@@H]2C[C@@H](N3[C@@H]4CCC[C@H]3CC(n3c(=O)c(-c5cccc(=O)[nH]5)nc5ccccc53)C4)CC1(C)C2.[H][H] |
| InChI | InChI=1S/C31H38N4O2.H2/c1-19-13-20-14-24(18-31(19,2)17-20)34-21-7-5-8-22(34)16-23(15-21)35-27-11-4-3-9-25(27)33-29(30(35)37)26-10-6-12-28(36)32-26;/h3-4,6,9-12,19-24H,5,7-8,13-18H2,1-2H3,(H,32,36);1H/t19-,20-,21-,22+,23?,24-,31?;/m1./s1 |
| InChIKey | VEYDLTBLAOTEPA-ZPLXHAMASA-N |
| XLogP | 5.77 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |