About 7,8-dimethyl-1,3-dihydro-3-benzazepin-2-one;ethane
7,8-dimethyl-1,3-dihydro-3-benzazepin-2-one;ethane (PubChem CID 144564580) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is 7,8-dimethyl-1,3-dihydro-3-benzazepin-2-one;ethane.
Molecular Properties
| Compound Name | 7,8-dimethyl-1,3-dihydro-3-benzazepin-2-one;ethane |
| PubChem CID | 144564580 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 7,8-dimethyl-1,3-dihydro-3-benzazepin-2-one;ethane |
| SMILES | CC.Cc1cc2c(cc1C)CC(=O)NC=C2 |
| InChI | InChI=1S/C12H13NO.C2H6/c1-8-5-10-3-4-13-12(14)7-11(10)6-9(8)2;1-2/h3-6H,7H2,1-2H3,(H,13,14);1-2H3 |
| InChIKey | ZPEPUBCGRYJPDG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7,8-dimethyl-1,3-dihydro-3-benzazepin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethyl-1,3-dihydro-3-benzazepin-2-one;ethane?
The IUPAC name of 7,8-dimethyl-1,3-dihydro-3-benzazepin-2-one;ethane (CID 144564580) is 7,8-dimethyl-1,3-dihydro-3-benzazepin-2-one;ethane.
What is the SMILES notation for 7,8-dimethyl-1,3-dihydro-3-benzazepin-2-one;ethane?
The canonical SMILES for 7,8-dimethyl-1,3-dihydro-3-benzazepin-2-one;ethane is CC.Cc1cc2c(cc1C)CC(=O)NC=C2.
What is the InChIKey of 7,8-dimethyl-1,3-dihydro-3-benzazepin-2-one;ethane?
The InChIKey is ZPEPUBCGRYJPDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO.C2H6/c1-8-5-10-3-4-13-12(14)7-11(10)6-9(8)2;1-2/h3-6H,7H2,1-2H3,(H,13,14);1-2H3.
What are the key properties of 7,8-dimethyl-1,3-dihydro-3-benzazepin-2-one;ethane?
7,8-dimethyl-1,3-dihydro-3-benzazepin-2-one;ethane has a molecular weight of 217.31 g/mol, XLogP of 2.97, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethyl-1,3-dihydro-3-benzazepin-2-one;ethane is sourced from PubChem (CID 144564580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).