C13H15N3O — CID 144565497
4-[(3E,5E)-6-aminoocta-1,3,5,7-tetraen-3-yl]oxypyridin-2-amine (PubChem CID 144565497) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 4-[(3E,5E)-6-aminoocta-1,3,5,7-tetraen-3-yl]oxypyridin-2-amine.
| Compound Name | 4-[(3E,5E)-6-aminoocta-1,3,5,7-tetraen-3-yl]oxypyridin-2-amine |
|---|---|
| PubChem CID | 144565497 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 4-[(3E,5E)-6-aminoocta-1,3,5,7-tetraen-3-yl]oxypyridin-2-amine |
| SMILES | C=C/C(N)=C\C=C(/C=C)Oc1ccnc(N)c1 |
| InChI | InChI=1S/C13H15N3O/c1-3-10(14)5-6-11(4-2)17-12-7-8-16-13(15)9-12/h3-9H,1-2,14H2,(H2,15,16)/b10-5+,11-6+ |
| InChIKey | OOYFTCLUWQQZTP-YOYBCKCWSA-N |
| XLogP | 2.14 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|