C23H25N3O2S — CID 144565556
4,6-dimethyl-8-(4-methylpentoxy)-9-(1,3-thiazol-5-yl)benzo[c][2,7]naphthyridin-5-one (PubChem CID 144565556) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 4,6-dimethyl-8-(4-methylpentoxy)-9-(1,3-thiazol-5-yl)benzo[c][2,7]naphthyridin-5-one.
| Compound Name | 4,6-dimethyl-8-(4-methylpentoxy)-9-(1,3-thiazol-5-yl)benzo[c][2,7]naphthyridin-5-one |
|---|---|
| PubChem CID | 144565556 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 4,6-dimethyl-8-(4-methylpentoxy)-9-(1,3-thiazol-5-yl)benzo[c][2,7]naphthyridin-5-one |
| SMILES | Cc1nccc2c1c(=O)n(C)c1cc(OCCCC(C)C)c(-c3cncs3)cc21 |
| InChI | InChI=1S/C23H25N3O2S/c1-14(2)6-5-9-28-20-11-19-17(10-18(20)21-12-24-13-29-21)16-7-8-25-15(3)22(16)23(27)26(19)4/h7-8,10-14H,5-6,9H2,1-4H3 |
| InChIKey | HFMOPMHFBGPRPK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|