About 4,6-dimethyl-8-(4-methylpentoxy)-9-methylsulfinylbenzo[c][2,7]naphthyridin-5-one;ethane
4,6-dimethyl-8-(4-methylpentoxy)-9-methylsulfinylbenzo[c][2,7]naphthyridin-5-one;ethane (PubChem CID 144565646) has the molecular formula C23H32N2O3S
and a molecular weight of 416.59 g/mol. Its IUPAC name is 4,6-dimethyl-8-(4-methylpentoxy)-9-methylsulfinylbenzo[c][2,7]naphthyridin-5-one;ethane.
Molecular Properties
| Compound Name | 4,6-dimethyl-8-(4-methylpentoxy)-9-methylsulfinylbenzo[c][2,7]naphthyridin-5-one;ethane |
| PubChem CID | 144565646 |
| Molecular Formula | C23H32N2O3S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 4,6-dimethyl-8-(4-methylpentoxy)-9-methylsulfinylbenzo[c][2,7]naphthyridin-5-one;ethane |
| SMILES | CC.Cc1nccc2c1c(=O)n(C)c1cc(OCCCC(C)C)c(S(C)=O)cc21 |
| InChI | InChI=1S/C21H26N2O3S.C2H6/c1-13(2)7-6-10-26-18-12-17-16(11-19(18)27(5)25)15-8-9-22-14(3)20(15)21(24)23(17)4;1-2/h8-9,11-13H,6-7,10H2,1-5H3;1-2H3 |
| InChIKey | WUBQQEIVRKADSZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dimethyl-8-(4-methylpentoxy)-9-methylsulfinylbenzo[c][2,7]naphthyridin-5-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-8-(4-methylpentoxy)-9-methylsulfinylbenzo[c][2,7]naphthyridin-5-one;ethane?
The IUPAC name of 4,6-dimethyl-8-(4-methylpentoxy)-9-methylsulfinylbenzo[c][2,7]naphthyridin-5-one;ethane (CID 144565646) is 4,6-dimethyl-8-(4-methylpentoxy)-9-methylsulfinylbenzo[c][2,7]naphthyridin-5-one;ethane.
What is the SMILES notation for 4,6-dimethyl-8-(4-methylpentoxy)-9-methylsulfinylbenzo[c][2,7]naphthyridin-5-one;ethane?
The canonical SMILES for 4,6-dimethyl-8-(4-methylpentoxy)-9-methylsulfinylbenzo[c][2,7]naphthyridin-5-one;ethane is CC.Cc1nccc2c1c(=O)n(C)c1cc(OCCCC(C)C)c(S(C)=O)cc21.
What is the InChIKey of 4,6-dimethyl-8-(4-methylpentoxy)-9-methylsulfinylbenzo[c][2,7]naphthyridin-5-one;ethane?
The InChIKey is WUBQQEIVRKADSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O3S.C2H6/c1-13(2)7-6-10-26-18-12-17-16(11-19(18)27(5)25)15-8-9-22-14(3)20(15)21(24)23(17)4;1-2/h8-9,11-13H,6-7,10H2,1-5H3;1-2H3.
What are the key properties of 4,6-dimethyl-8-(4-methylpentoxy)-9-methylsulfinylbenzo[c][2,7]naphthyridin-5-one;ethane?
4,6-dimethyl-8-(4-methylpentoxy)-9-methylsulfinylbenzo[c][2,7]naphthyridin-5-one;ethane has a molecular weight of 416.59 g/mol, XLogP of 4.97, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-8-(4-methylpentoxy)-9-methylsulfinylbenzo[c][2,7]naphthyridin-5-one;ethane is sourced from PubChem (CID 144565646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).