About ethane;2-methyl-6H-[1,3]thiazolo[5,4-b]azepine
ethane;2-methyl-6H-[1,3]thiazolo[5,4-b]azepine (PubChem CID 144565837) has the molecular formula C10H14N2S
and a molecular weight of 194.30 g/mol. Its IUPAC name is ethane;2-methyl-6H-[1,3]thiazolo[5,4-b]azepine.
Molecular Properties
| Compound Name | ethane;2-methyl-6H-[1,3]thiazolo[5,4-b]azepine |
| PubChem CID | 144565837 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | ethane;2-methyl-6H-[1,3]thiazolo[5,4-b]azepine |
| SMILES | CC.Cc1nc2c(s1)N=CCC=C2 |
| InChI | InChI=1S/C8H8N2S.C2H6/c1-6-10-7-4-2-3-5-9-8(7)11-6;1-2/h2,4-5H,3H2,1H3;1-2H3 |
| InChIKey | XODGOVNTWRFCKW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-methyl-6H-[1,3]thiazolo[5,4-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-6H-[1,3]thiazolo[5,4-b]azepine?
The IUPAC name of ethane;2-methyl-6H-[1,3]thiazolo[5,4-b]azepine (CID 144565837) is ethane;2-methyl-6H-[1,3]thiazolo[5,4-b]azepine.
What is the SMILES notation for ethane;2-methyl-6H-[1,3]thiazolo[5,4-b]azepine?
The canonical SMILES for ethane;2-methyl-6H-[1,3]thiazolo[5,4-b]azepine is CC.Cc1nc2c(s1)N=CCC=C2.
What is the InChIKey of ethane;2-methyl-6H-[1,3]thiazolo[5,4-b]azepine?
The InChIKey is XODGOVNTWRFCKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2S.C2H6/c1-6-10-7-4-2-3-5-9-8(7)11-6;1-2/h2,4-5H,3H2,1H3;1-2H3.
What are the key properties of ethane;2-methyl-6H-[1,3]thiazolo[5,4-b]azepine?
ethane;2-methyl-6H-[1,3]thiazolo[5,4-b]azepine has a molecular weight of 194.30 g/mol, XLogP of 3.60, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-6H-[1,3]thiazolo[5,4-b]azepine is sourced from PubChem (CID 144565837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).