C24H20ClN3O — CID 144566465
2-(2-chloroquinolin-8-yl)-7-[(3-methylphenyl)methyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 144566465) has the molecular formula C24H20ClN3O and a molecular weight of 401.90 g/mol. Its IUPAC name is 2-(2-chloroquinolin-8-yl)-7-[(3-methylphenyl)methyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 2-(2-chloroquinolin-8-yl)-7-[(3-methylphenyl)methyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 144566465 |
| Molecular Formula | C24H20ClN3O |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-(2-chloroquinolin-8-yl)-7-[(3-methylphenyl)methyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | Cc1cccc(CC2CNC(=O)c3cc(-c4cccc5ccc(Cl)nc45)[nH]c32)c1 |
| InChI | InChI=1S/C24H20ClN3O/c1-14-4-2-5-15(10-14)11-17-13-26-24(29)19-12-20(27-23(17)19)18-7-3-6-16-8-9-21(25)28-22(16)18/h2-10,12,17,27H,11,13H2,1H3,(H,26,29) |
| InChIKey | SOFIMNRDHRTHGY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|