C21H20N4OS — CID 144566506
(11E)-12,16-dimethyl-14-thia-3,7,17,23-tetrazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(22),2(24),4,11,15(23),16,18,20-octaen-6-one (PubChem CID 144566506) has the molecular formula C21H20N4OS and a molecular weight of 376.49 g/mol. Its IUPAC name is (11E)-12,16-dimethyl-14-thia-3,7,17,23-tetrazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(22),2(24),4,11,15(23),16,18,20-octaen-6-one.
| Compound Name | (11E)-12,16-dimethyl-14-thia-3,7,17,23-tetrazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(22),2(24),4,11,15(23),16,18,20-octaen-6-one |
|---|---|
| PubChem CID | 144566506 |
| Molecular Formula | C21H20N4OS |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (11E)-12,16-dimethyl-14-thia-3,7,17,23-tetrazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(22),2(24),4,11,15(23),16,18,20-octaen-6-one |
| SMILES | C/C1=C/CC2CNC(=O)c3cc([nH]c32)-c2cccc3nc(C)c(nc23)SC1 |
| InChI | InChI=1S/C21H20N4OS/c1-11-6-7-13-9-22-20(26)15-8-17(24-18(13)15)14-4-3-5-16-19(14)25-21(27-10-11)12(2)23-16/h3-6,8,13,24H,7,9-10H2,1-2H3,(H,22,26)/b11-6- |
| InChIKey | AYBSQLBIZKIHCV-WDZFZDKYSA-N |
| XLogP | 4.20 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|