C26H42O2 — CID 144566736
(1R,4R,6S,8S,13S,16S)-9,13-dimethyl-6-(3-methylbutyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-ol (PubChem CID 144566736) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is (1R,4R,6S,8S,13S,16S)-9,13-dimethyl-6-(3-methylbutyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-ol.
| Compound Name | (1R,4R,6S,8S,13S,16S)-9,13-dimethyl-6-(3-methylbutyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-ol |
|---|---|
| PubChem CID | 144566736 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | (1R,4R,6S,8S,13S,16S)-9,13-dimethyl-6-(3-methylbutyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-ol |
| SMILES | CC(C)CC[C@H]1C[C@@H]2[C@@H](CC3[C@H]4CC=C5C[C@@H](O)CC[C@@]5(C)C4CCC32C)O1 |
| InChI | InChI=1S/C26H42O2/c1-16(2)5-7-19-14-23-24(28-19)15-22-20-8-6-17-13-18(27)9-11-25(17,3)21(20)10-12-26(22,23)4/h6,16,18-24,27H,5,7-15H2,1-4H3/t18-,19-,20-,21?,22?,23+,24+,25+,26?/m0/s1 |
| InChIKey | JMXRBSVNHNJWJZ-OKWIMPQKSA-N |
| XLogP | 6.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|