C21H16F4N8O — CID 144567144
4-fluoroaniline;2-[(7H-purin-6-ylamino)methyl]-5-(trifluoromethyl)-3H-quinazolin-4-one (PubChem CID 144567144) has the molecular formula C21H16F4N8O and a molecular weight of 472.41 g/mol. Its IUPAC name is 4-fluoroaniline;2-[(7H-purin-6-ylamino)methyl]-5-(trifluoromethyl)-3H-quinazolin-4-one.
| Compound Name | 4-fluoroaniline;2-[(7H-purin-6-ylamino)methyl]-5-(trifluoromethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 144567144 |
| Molecular Formula | C21H16F4N8O |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 4-fluoroaniline;2-[(7H-purin-6-ylamino)methyl]-5-(trifluoromethyl)-3H-quinazolin-4-one |
| SMILES | Nc1ccc(F)cc1.O=c1[nH]c(CNc2ncnc3nc[nH]c23)nc2cccc(C(F)(F)F)c12 |
| InChI | InChI=1S/C15H10F3N7O.C6H6FN/c16-15(17,18)7-2-1-3-8-10(7)14(26)25-9(24-8)4-19-12-11-13(21-5-20-11)23-6-22-12;7-5-1-3-6(8)4-2-5/h1-3,5-6H,4H2,(H,24,25,26)(H2,19,20,21,22,23);1-4H,8H2 |
| InChIKey | NIFWRXWKKMJTOL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|