About 1-O-tert-butyl 5-O-methyl 2-oxopentanedioate
1-O-tert-butyl 5-O-methyl 2-oxopentanedioate (PubChem CID 14456778) has the molecular formula C10H16O5
and a molecular weight of 216.23 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-methyl 2-oxopentanedioate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 5-O-methyl 2-oxopentanedioate |
| PubChem CID | 14456778 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 1-O-tert-butyl 5-O-methyl 2-oxopentanedioate |
| SMILES | COC(=O)CCC(=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H16O5/c1-10(2,3)15-9(13)7(11)5-6-8(12)14-4/h5-6H2,1-4H3 |
| InChIKey | ARCRPVYHQKJNGU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 5-O-methyl 2-oxopentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 5-O-methyl 2-oxopentanedioate?
The IUPAC name of 1-O-tert-butyl 5-O-methyl 2-oxopentanedioate (CID 14456778) is 1-O-tert-butyl 5-O-methyl 2-oxopentanedioate.
What is the SMILES notation for 1-O-tert-butyl 5-O-methyl 2-oxopentanedioate?
The canonical SMILES for 1-O-tert-butyl 5-O-methyl 2-oxopentanedioate is COC(=O)CCC(=O)C(=O)OC(C)(C)C.
What is the InChIKey of 1-O-tert-butyl 5-O-methyl 2-oxopentanedioate?
The InChIKey is ARCRPVYHQKJNGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O5/c1-10(2,3)15-9(13)7(11)5-6-8(12)14-4/h5-6H2,1-4H3.
What are the key properties of 1-O-tert-butyl 5-O-methyl 2-oxopentanedioate?
1-O-tert-butyl 5-O-methyl 2-oxopentanedioate has a molecular weight of 216.23 g/mol, XLogP of 0.85, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 5-O-methyl 2-oxopentanedioate is sourced from PubChem (CID 14456778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).