C20H18FNO — CID 144567873
7-fluoro-2-imino-9-methyl-5-phenyl-4,4a,4b,5-tetrahydro-3H-fluoren-1-one (PubChem CID 144567873) has the molecular formula C20H18FNO and a molecular weight of 307.37 g/mol. Its IUPAC name is 7-fluoro-2-imino-9-methyl-5-phenyl-4,4a,4b,5-tetrahydro-3H-fluoren-1-one.
| Compound Name | 7-fluoro-2-imino-9-methyl-5-phenyl-4,4a,4b,5-tetrahydro-3H-fluoren-1-one |
|---|---|
| PubChem CID | 144567873 |
| Molecular Formula | C20H18FNO |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 7-fluoro-2-imino-9-methyl-5-phenyl-4,4a,4b,5-tetrahydro-3H-fluoren-1-one |
| SMILES | [H]/N=C1\CCC2C(=C(C)C3=CC(F)=CC(c4ccccc4)C32)C1=O |
| InChI | InChI=1S/C20H18FNO/c1-11-15-9-13(21)10-16(12-5-3-2-4-6-12)19(15)14-7-8-17(22)20(23)18(11)14/h2-6,9-10,14,16,19,22H,7-8H2,1H3/b22-17+ |
| InChIKey | GVGALUTUMPUIPL-OQKWZONESA-N |
| XLogP | 4.51 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|