C32H43N5O4S — CID 144568112
9-[5-(2-methoxyquinolin-3-yl)-1,3-oxazol-2-yl]nonan-3-one;3-(piperidin-1-ylmethyl)-4,5-dihydro-1,2-thiazole-5-carboxamide (PubChem CID 144568112) has the molecular formula C32H43N5O4S and a molecular weight of 593.79 g/mol. Its IUPAC name is 9-[5-(2-methoxyquinolin-3-yl)-1,3-oxazol-2-yl]nonan-3-one;3-(piperidin-1-ylmethyl)-4,5-dihydro-1,2-thiazole-5-carboxamide.
| Compound Name | 9-[5-(2-methoxyquinolin-3-yl)-1,3-oxazol-2-yl]nonan-3-one;3-(piperidin-1-ylmethyl)-4,5-dihydro-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 144568112 |
| Molecular Formula | C32H43N5O4S |
| Molecular Weight | 593.79 g/mol |
| Exact Mass | 593.30 |
| IUPAC Name | 9-[5-(2-methoxyquinolin-3-yl)-1,3-oxazol-2-yl]nonan-3-one;3-(piperidin-1-ylmethyl)-4,5-dihydro-1,2-thiazole-5-carboxamide |
| SMILES | CCC(=O)CCCCCCc1ncc(-c2cc3ccccc3nc2OC)o1.NC(=O)C1CC(CN2CCCCC2)=NS1 |
| InChI | InChI=1S/C22H26N2O3.C10H17N3OS/c1-3-17(25)11-6-4-5-7-13-21-23-15-20(27-21)18-14-16-10-8-9-12-19(16)24-22(18)26-2;11-10(14)9-6-8(12-15-9)7-13-4-2-1-3-5-13/h8-10,12,14-15H,3-7,11,13H2,1-2H3;9H,1-7H2,(H2,11,14) |
| InChIKey | MVQWIFPGVZXXMN-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.79 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|