C13H19NO — CID 144568354
N-methyl-N-[(2E,4E,6E)-octa-2,4,6-trien-4-yl]cyclopropanecarboxamide (PubChem CID 144568354) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is N-methyl-N-[(2E,4E,6E)-octa-2,4,6-trien-4-yl]cyclopropanecarboxamide.
| Compound Name | N-methyl-N-[(2E,4E,6E)-octa-2,4,6-trien-4-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 144568354 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | N-methyl-N-[(2E,4E,6E)-octa-2,4,6-trien-4-yl]cyclopropanecarboxamide |
| SMILES | C/C=C/C=C(\C=C\C)N(C)C(=O)C1CC1 |
| InChI | InChI=1S/C13H19NO/c1-4-6-8-12(7-5-2)14(3)13(15)11-9-10-11/h4-8,11H,9-10H2,1-3H3/b6-4+,7-5+,12-8+ |
| InChIKey | YNEUEQBPZZMLSR-FOTIZBECSA-N |
| XLogP | 2.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|