C48H38N6 — CID 144568528
(1Z,3E)-3-[7-[(1Z,3E)-1-aminopenta-1,3-dien-3-yl]-3,6,10,11-tetrapyridin-4-yltriphenylen-2-yl]penta-1,3-dien-1-amine (PubChem CID 144568528) has the molecular formula C48H38N6 and a molecular weight of 698.87 g/mol. Its IUPAC name is (1Z,3E)-3-[7-[(1Z,3E)-1-aminopenta-1,3-dien-3-yl]-3,6,10,11-tetrapyridin-4-yltriphenylen-2-yl]penta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-3-[7-[(1Z,3E)-1-aminopenta-1,3-dien-3-yl]-3,6,10,11-tetrapyridin-4-yltriphenylen-2-yl]penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 144568528 |
| Molecular Formula | C48H38N6 |
| Molecular Weight | 698.87 g/mol |
| Exact Mass | 698.32 |
| IUPAC Name | (1Z,3E)-3-[7-[(1Z,3E)-1-aminopenta-1,3-dien-3-yl]-3,6,10,11-tetrapyridin-4-yltriphenylen-2-yl]penta-1,3-dien-1-amine |
| SMILES | C/C=C(\C=C/N)c1cc2c(cc1-c1ccncc1)c1cc(-c3ccncc3)c(C(/C=C\N)=C/C)cc1c1cc(-c3ccncc3)c(-c3ccncc3)cc21 |
| InChI | InChI=1S/C48H38N6/c1-3-31(5-15-49)37-25-43-45(27-39(37)33-7-17-51-18-8-33)46-28-40(34-9-19-52-20-10-34)38(32(4-2)6-16-50)26-44(46)48-30-42(36-13-23-54-24-14-36)41(29-47(43)48)35-11-21-53-22-12-35/h3-30H,49-50H2,1-2H3/b15-5-,16-6-,31-3+,32-4+ |
| InChIKey | DEXYVLQUWQGFTF-AEZJTHRASA-N |
| XLogP | 11.15 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.87 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|