About phenylmethanimine;1,1,1-trifluoro-2-phenylbutan-2-ol
phenylmethanimine;1,1,1-trifluoro-2-phenylbutan-2-ol (PubChem CID 144568711) has the molecular formula C17H18F3NO
and a molecular weight of 309.33 g/mol. Its IUPAC name is phenylmethanimine;1,1,1-trifluoro-2-phenylbutan-2-ol.
Molecular Properties
| Compound Name | phenylmethanimine;1,1,1-trifluoro-2-phenylbutan-2-ol |
| PubChem CID | 144568711 |
| Molecular Formula | C17H18F3NO |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | phenylmethanimine;1,1,1-trifluoro-2-phenylbutan-2-ol |
| SMILES | CCC(O)(c1ccccc1)C(F)(F)F.[H]/N=C/c1ccccc1 |
| InChI | InChI=1S/C10H11F3O.C7H7N/c1-2-9(14,10(11,12)13)8-6-4-3-5-7-8;8-6-7-4-2-1-3-5-7/h3-7,14H,2H2,1H3;1-6,8H/b;8-6+ |
| InChIKey | ISRPCIGBJUGTLS-ZQGZPJDTSA-N |
| XLogP | 4.53 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze phenylmethanimine;1,1,1-trifluoro-2-phenylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethanimine;1,1,1-trifluoro-2-phenylbutan-2-ol?
The IUPAC name of phenylmethanimine;1,1,1-trifluoro-2-phenylbutan-2-ol (CID 144568711) is phenylmethanimine;1,1,1-trifluoro-2-phenylbutan-2-ol.
What is the SMILES notation for phenylmethanimine;1,1,1-trifluoro-2-phenylbutan-2-ol?
The canonical SMILES for phenylmethanimine;1,1,1-trifluoro-2-phenylbutan-2-ol is CCC(O)(c1ccccc1)C(F)(F)F.[H]/N=C/c1ccccc1.
What is the InChIKey of phenylmethanimine;1,1,1-trifluoro-2-phenylbutan-2-ol?
The InChIKey is ISRPCIGBJUGTLS-ZQGZPJDTSA-N. The full InChI is InChI=1S/C10H11F3O.C7H7N/c1-2-9(14,10(11,12)13)8-6-4-3-5-7-8;8-6-7-4-2-1-3-5-7/h3-7,14H,2H2,1H3;1-6,8H/b;8-6+.
What are the key properties of phenylmethanimine;1,1,1-trifluoro-2-phenylbutan-2-ol?
phenylmethanimine;1,1,1-trifluoro-2-phenylbutan-2-ol has a molecular weight of 309.33 g/mol, XLogP of 4.53, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethanimine;1,1,1-trifluoro-2-phenylbutan-2-ol is sourced from PubChem (CID 144568711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).