About S-(5-oxopyrrolidin-3-yl) ethanethioate
S-(5-oxopyrrolidin-3-yl) ethanethioate (PubChem CID 14456882) has the molecular formula C6H9NO2S
and a molecular weight of 159.21 g/mol. Its IUPAC name is S-(5-oxopyrrolidin-3-yl) ethanethioate.
Molecular Properties
| Compound Name | S-(5-oxopyrrolidin-3-yl) ethanethioate |
| PubChem CID | 14456882 |
| Molecular Formula | C6H9NO2S |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | S-(5-oxopyrrolidin-3-yl) ethanethioate |
| SMILES | CC(=O)SC1CNC(=O)C1 |
| InChI | InChI=1S/C6H9NO2S/c1-4(8)10-5-2-6(9)7-3-5/h5H,2-3H2,1H3,(H,7,9) |
| InChIKey | RCGMCMAJECIOHO-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(5-oxopyrrolidin-3-yl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(5-oxopyrrolidin-3-yl) ethanethioate?
The IUPAC name of S-(5-oxopyrrolidin-3-yl) ethanethioate (CID 14456882) is S-(5-oxopyrrolidin-3-yl) ethanethioate.
What is the SMILES notation for S-(5-oxopyrrolidin-3-yl) ethanethioate?
The canonical SMILES for S-(5-oxopyrrolidin-3-yl) ethanethioate is CC(=O)SC1CNC(=O)C1.
What is the InChIKey of S-(5-oxopyrrolidin-3-yl) ethanethioate?
The InChIKey is RCGMCMAJECIOHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2S/c1-4(8)10-5-2-6(9)7-3-5/h5H,2-3H2,1H3,(H,7,9).
What are the key properties of S-(5-oxopyrrolidin-3-yl) ethanethioate?
S-(5-oxopyrrolidin-3-yl) ethanethioate has a molecular weight of 159.21 g/mol, XLogP of 0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(5-oxopyrrolidin-3-yl) ethanethioate is sourced from PubChem (CID 14456882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).