C4H7NO3 — CID 14456889
4-(hydroxymethyl)-1,3-oxazolidin-2-one (PubChem CID 14456889) has the molecular formula C4H7NO3 and a molecular weight of 117.10 g/mol. Its IUPAC name is 4-(hydroxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | 4-(hydroxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 14456889 |
| Molecular Formula | C4H7NO3 |
| Molecular Weight | 117.10 g/mol |
| Exact Mass | 117.04 |
| IUPAC Name | 4-(hydroxymethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(CO)CO1 |
| InChI | InChI=1S/C4H7NO3/c6-1-3-2-8-4(7)5-3/h3,6H,1-2H2,(H,5,7) |
| InChIKey | MEXGFDVEUOGVFI-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.10 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |