C20H26O4 — CID 144568962
methyl (E)-3-[4-[4-(2-methoxyethoxy)-3-methylcyclohexa-2,4-dien-1-yl]cyclohexa-1,5-dien-1-yl]prop-2-enoate (PubChem CID 144568962) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is methyl (E)-3-[4-[4-(2-methoxyethoxy)-3-methylcyclohexa-2,4-dien-1-yl]cyclohexa-1,5-dien-1-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[4-(2-methoxyethoxy)-3-methylcyclohexa-2,4-dien-1-yl]cyclohexa-1,5-dien-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 144568962 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | methyl (E)-3-[4-[4-(2-methoxyethoxy)-3-methylcyclohexa-2,4-dien-1-yl]cyclohexa-1,5-dien-1-yl]prop-2-enoate |
| SMILES | COCCOC1=CCC(C2C=CC(/C=C/C(=O)OC)=CC2)C=C1C |
| InChI | InChI=1S/C20H26O4/c1-15-14-18(9-10-19(15)24-13-12-22-2)17-7-4-16(5-8-17)6-11-20(21)23-3/h4-7,10-11,14,17-18H,8-9,12-13H2,1-3H3/b11-6+ |
| InChIKey | PHMSHGUPGSYMOU-IZZDOVSWSA-N |
| XLogP | 3.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|