C13H8N2S — CID 144569176
3-thia-14,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),4,7,10(15),11,13-heptaene (PubChem CID 144569176) has the molecular formula C13H8N2S and a molecular weight of 224.29 g/mol. Its IUPAC name is 3-thia-14,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),4,7,10(15),11,13-heptaene.
| Compound Name | 3-thia-14,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),4,7,10(15),11,13-heptaene |
|---|---|
| PubChem CID | 144569176 |
| Molecular Formula | C13H8N2S |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 3-thia-14,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),4,7,10(15),11,13-heptaene |
| SMILES | c1cnc2[nH]c3c(ccc4ccsc43)c2c1 |
| InChI | InChI=1S/C13H8N2S/c1-2-10-9-4-3-8-5-7-16-12(8)11(9)15-13(10)14-6-1/h1-7H,(H,14,15) |
| InChIKey | BRJLBEXMVBTNQC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |