About N'-(2-cyclohepta-1,4,6-trien-1-ylethyl)-4-methyl-N-methylidenebenzenecarboximidamide
N'-(2-cyclohepta-1,4,6-trien-1-ylethyl)-4-methyl-N-methylidenebenzenecarboximidamide (PubChem CID 144569212) has the molecular formula C18H20N2
and a molecular weight of 264.37 g/mol. Its IUPAC name is N'-(2-cyclohepta-1,4,6-trien-1-ylethyl)-4-methyl-N-methylidenebenzenecarboximidamide.
Molecular Properties
| Compound Name | N'-(2-cyclohepta-1,4,6-trien-1-ylethyl)-4-methyl-N-methylidenebenzenecarboximidamide |
| PubChem CID | 144569212 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | N'-(2-cyclohepta-1,4,6-trien-1-ylethyl)-4-methyl-N-methylidenebenzenecarboximidamide |
| SMILES | C=N/C(=N\CCC1=CCC=CC=C1)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H20N2/c1-15-9-11-17(12-10-15)18(19-2)20-14-13-16-7-5-3-4-6-8-16/h3-5,7-12H,2,6,13-14H2,1H3/b20-18- |
| InChIKey | HSMVAFGPOCQFGS-ZZEZOPTASA-N |
| XLogP | 4.27 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-cyclohepta-1,4,6-trien-1-ylethyl)-4-methyl-N-methylidenebenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-cyclohepta-1,4,6-trien-1-ylethyl)-4-methyl-N-methylidenebenzenecarboximidamide?
The IUPAC name of N'-(2-cyclohepta-1,4,6-trien-1-ylethyl)-4-methyl-N-methylidenebenzenecarboximidamide (CID 144569212) is N'-(2-cyclohepta-1,4,6-trien-1-ylethyl)-4-methyl-N-methylidenebenzenecarboximidamide.
What is the SMILES notation for N'-(2-cyclohepta-1,4,6-trien-1-ylethyl)-4-methyl-N-methylidenebenzenecarboximidamide?
The canonical SMILES for N'-(2-cyclohepta-1,4,6-trien-1-ylethyl)-4-methyl-N-methylidenebenzenecarboximidamide is C=N/C(=N\CCC1=CCC=CC=C1)c1ccc(C)cc1.
What is the InChIKey of N'-(2-cyclohepta-1,4,6-trien-1-ylethyl)-4-methyl-N-methylidenebenzenecarboximidamide?
The InChIKey is HSMVAFGPOCQFGS-ZZEZOPTASA-N. The full InChI is InChI=1S/C18H20N2/c1-15-9-11-17(12-10-15)18(19-2)20-14-13-16-7-5-3-4-6-8-16/h3-5,7-12H,2,6,13-14H2,1H3/b20-18-.
What are the key properties of N'-(2-cyclohepta-1,4,6-trien-1-ylethyl)-4-methyl-N-methylidenebenzenecarboximidamide?
N'-(2-cyclohepta-1,4,6-trien-1-ylethyl)-4-methyl-N-methylidenebenzenecarboximidamide has a molecular weight of 264.37 g/mol, XLogP of 4.27, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-cyclohepta-1,4,6-trien-1-ylethyl)-4-methyl-N-methylidenebenzenecarboximidamide is sourced from PubChem (CID 144569212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).