About 2-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(4-methylphenyl)pyridine
2-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(4-methylphenyl)pyridine (PubChem CID 144569411) has the molecular formula C17H17N
and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(4-methylphenyl)pyridine.
Molecular Properties
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(4-methylphenyl)pyridine |
| PubChem CID | 144569411 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(4-methylphenyl)pyridine |
| SMILES | C=C/C=C\c1nc(-c2ccc(C)cc2)ccc1C |
| InChI | InChI=1S/C17H17N/c1-4-5-6-16-14(3)9-12-17(18-16)15-10-7-13(2)8-11-15/h4-12H,1H2,2-3H3/b6-5- |
| InChIKey | VCTFEAMSJAEWTF-WAYWQWQTSA-N |
| XLogP | 4.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(4-methylphenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(4-methylphenyl)pyridine?
The IUPAC name of 2-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(4-methylphenyl)pyridine (CID 144569411) is 2-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(4-methylphenyl)pyridine.
What is the SMILES notation for 2-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(4-methylphenyl)pyridine?
The canonical SMILES for 2-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(4-methylphenyl)pyridine is C=C/C=C\c1nc(-c2ccc(C)cc2)ccc1C.
What is the InChIKey of 2-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(4-methylphenyl)pyridine?
The InChIKey is VCTFEAMSJAEWTF-WAYWQWQTSA-N. The full InChI is InChI=1S/C17H17N/c1-4-5-6-16-14(3)9-12-17(18-16)15-10-7-13(2)8-11-15/h4-12H,1H2,2-3H3/b6-5-.
What are the key properties of 2-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(4-methylphenyl)pyridine?
2-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(4-methylphenyl)pyridine has a molecular weight of 235.33 g/mol, XLogP of 4.56, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1Z)-buta-1,3-dienyl]-3-methyl-6-(4-methylphenyl)pyridine is sourced from PubChem (CID 144569411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).