C38H36BN3O2 — CID 144569501
5-methyl-3,10-diphenyl-7-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-4,5-dihydropyrrolo[3,2-a]carbazole (PubChem CID 144569501) has the molecular formula C38H36BN3O2 and a molecular weight of 577.54 g/mol. Its IUPAC name is 5-methyl-3,10-diphenyl-7-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-4,5-dihydropyrrolo[3,2-a]carbazole.
| Compound Name | 5-methyl-3,10-diphenyl-7-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-4,5-dihydropyrrolo[3,2-a]carbazole |
|---|---|
| PubChem CID | 144569501 |
| Molecular Formula | C38H36BN3O2 |
| Molecular Weight | 577.54 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | 5-methyl-3,10-diphenyl-7-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-4,5-dihydropyrrolo[3,2-a]carbazole |
| SMILES | CC1Cc2c(ccn2-c2ccccc2)-c2c1c1cc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cn3)ccc1n2-c1ccccc1 |
| InChI | InChI=1S/C38H36BN3O2/c1-25-22-34-30(20-21-41(34)28-12-8-6-9-13-28)36-35(25)31-23-26(16-19-33(31)42(36)29-14-10-7-11-15-29)32-18-17-27(24-40-32)39-43-37(2,3)38(4,5)44-39/h6-21,23-25H,22H2,1-5H3 |
| InChIKey | CNPXBOJCNAWIPV-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 41.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.54 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|