About (4R)-3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-amine;3-fluoro-2-(trifluoromethoxy)pyridine
(4R)-3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-amine;3-fluoro-2-(trifluoromethoxy)pyridine (PubChem CID 144570066) has the molecular formula C14H13F4N3O2
and a molecular weight of 331.27 g/mol. Its IUPAC name is (4R)-3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-amine;3-fluoro-2-(trifluoromethoxy)pyridine.
Molecular Properties
| Compound Name | (4R)-3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-amine;3-fluoro-2-(trifluoromethoxy)pyridine |
| PubChem CID | 144570066 |
| Molecular Formula | C14H13F4N3O2 |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | (4R)-3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-amine;3-fluoro-2-(trifluoromethoxy)pyridine |
| SMILES | Fc1cccnc1OC(F)(F)F.N[C@@H]1CCOc2cccnc21 |
| InChI | InChI=1S/C8H10N2O.C6H3F4NO/c9-6-3-5-11-7-2-1-4-10-8(6)7;7-4-2-1-3-11-5(4)12-6(8,9)10/h1-2,4,6H,3,5,9H2;1-3H/t6-;/m1./s1 |
| InChIKey | JNBJEQMHXSBRNI-FYZOBXCZSA-N |
| XLogP | 2.98 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4R)-3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-amine;3-fluoro-2-(trifluoromethoxy)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-amine;3-fluoro-2-(trifluoromethoxy)pyridine?
The IUPAC name of (4R)-3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-amine;3-fluoro-2-(trifluoromethoxy)pyridine (CID 144570066) is (4R)-3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-amine;3-fluoro-2-(trifluoromethoxy)pyridine.
What is the SMILES notation for (4R)-3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-amine;3-fluoro-2-(trifluoromethoxy)pyridine?
The canonical SMILES for (4R)-3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-amine;3-fluoro-2-(trifluoromethoxy)pyridine is Fc1cccnc1OC(F)(F)F.N[C@@H]1CCOc2cccnc21.
What is the InChIKey of (4R)-3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-amine;3-fluoro-2-(trifluoromethoxy)pyridine?
The InChIKey is JNBJEQMHXSBRNI-FYZOBXCZSA-N. The full InChI is InChI=1S/C8H10N2O.C6H3F4NO/c9-6-3-5-11-7-2-1-4-10-8(6)7;7-4-2-1-3-11-5(4)12-6(8,9)10/h1-2,4,6H,3,5,9H2;1-3H/t6-;/m1./s1.
What are the key properties of (4R)-3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-amine;3-fluoro-2-(trifluoromethoxy)pyridine?
(4R)-3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-amine;3-fluoro-2-(trifluoromethoxy)pyridine has a molecular weight of 331.27 g/mol, XLogP of 2.98, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-amine;3-fluoro-2-(trifluoromethoxy)pyridine is sourced from PubChem (CID 144570066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).